A1203612
Bis(4-bromophenyl)amine , 98% , 16292-17-4
Synonym(s):
N-phenyl-4,4′-dibromoaniline;4,4′-Dibromodiphenylamine
CAS NO.:16292-17-4
Empirical Formula: C12H9Br2N
Molecular Weight: 327.01
MDL number: MFCD00225488
EINECS: 628-026-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 10G | RMB81.60 | In Stock |
|
| 25G | RMB148.00 | In Stock |
|
| 100G | RMB554.40 | In Stock |
|
| 500g | RMB2735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106 °C |
| Boiling point: | 380.5±27.0 °C(Predicted) |
| Density | 1.740±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -0.55±0.40(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H9Br2N/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,15H |
| InChIKey | VKVHTZNHLOGHGP-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(Br)C=C2)=CC=C(Br)C=C1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318-H413 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HS Code | 29214400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Dam. 1 |





![Bis[3-(trimethoxysilyl)propyl]amine](https://img.chemicalbook.com/CAS/GIF/82985-35-1.gif)


