A3270612
4,4'-Dibromotriphenylamine , 98% , 81090-53-1
Synonym(s):
N,N-Bis(4-bromophenyl)aniline
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.80 | In Stock |
|
| 5G | RMB244.80 | In Stock |
|
| 25g | RMB1033.60 | In Stock |
|
| 100g | RMB3879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69°C |
| Boiling point: | 470.7±30.0 °C(Predicted) |
| Density | 1.593 |
| Flash point: | 110 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -4.29±0.50(Predicted) |
| form | Solid |
| color | Off-white |
| InChI | InChI=1S/C18H13Br2N/c19-14-6-10-17(11-7-14)21(16-4-2-1-3-5-16)18-12-8-15(20)9-13-18/h1-13H |
| InChIKey | KIGVOJUDEQXKII-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(Br)C=C2)C2=CC=CC=C2)=CC=C(Br)C=C1 |
Description and Uses
4,4′-Dibromotriphenylamine is a brominated derivative of aniline, a primary aromatic amine. It is a synthetic reagent for proteomics research. It is also employed as a starting material in the synthesis of various compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | 3 |
| HS Code | 29214990 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |







