A7705512
Tris(4-bromophenyl)amine , 98% , 4316-58-9
CAS NO.:4316-58-9
Empirical Formula: C18H12Br3N
Molecular Weight: 482.01
MDL number: MFCD00009665
EINECS: 628-703-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB362.40 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143 °C (lit.) |
| Boiling point: | 514.9±45.0 °C(Predicted) |
| Density | 1.790±0.06 g/cm3(Predicted) |
| Flash point: | 100°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in toluene. |
| form | powder to crystal |
| pka | -4.91±0.50(Predicted) |
| color | White to Almost white |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| InChIKey | ZRXVCYGHAUGABY-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(Br)C=C2)C2=CC=C(Br)C=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 4316-58-9(CAS DataBase Reference) |
Description and Uses
Tris(4-bromophenyl)amine was used in the synthesis of porous luminescent covalent--organic polymers (COPs)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![4',4''',4'''''-Nitrilotris(([1,1'-biphenyl]-4-carboxylicacid))](https://img.chemicalbook.com/CAS/20150408/GIF/1239602-35-7.gif)
