A1571712
Bis[3-(trimethoxysilyl)propyl]amine , ≥90.0% , 82985-35-1
Synonym(s):
3,3′-Bis(trimethoxysilyl)dipropylamine
CAS NO.:82985-35-1
Empirical Formula: C12H31NO6Si2
Molecular Weight: 341.55
MDL number: MFCD00191835
EINECS: 280-084-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB99.20 | In Stock |
|
| 500G | RMB291.20 | In Stock |
|
| 2.5kg | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 152 °C4 mm Hg(lit.) |
| Density | 1.04 g/mL at 25 °C(lit.) |
| vapor pressure | 0-12790Pa at 20-25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C(protect from light) |
| form | clear liquid |
| pka | 10.78±0.19(Predicted) |
| Specific Gravity | 1.04 |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 34-1000g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 9569446 |
| InChI | 1S/C12H31NO6Si2/c1-14-20(15-2,16-3)11-7-9-13-10-8-12-21(17-4,18-5)19-6/h13H,7-12H2,1-6H3 |
| InChIKey | TZZGHGKTHXIOMN-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC |
| LogP | -4-0.2 at 20℃ |
| CAS DataBase Reference | 82985-35-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanamine, 3-(trimethoxysilyl)-N-[3-(trimethoxysilyl)propyl]- (82985-35-1) |
Description and Uses
Bis(trimethoxysilylpropyl)amine is used in method for dyeing keratinous material, comprising the use of an organosilicon compound, an effect pigment and a film-forming polymer.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 20/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TX2101000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |

![Bis[3-(trimethoxysilyl)propyl]amine](https://img.chemicalbook.com/CAS/GIF/82985-35-1.gif)


![N-[3-(Trimethoxysilyl)propyl]ethylenediamine](https://img.chemicalbook.com/CAS/GIF/1760-24-3.gif)


