A1203450
5α-Pregnane-3,20-dione , 97% , 566-65-4
Synonym(s):
5α-Dihydroprogesterone;Allopregnane-3,20-dione
CAS NO.:566-65-4
Empirical Formula: C21H32O2
Molecular Weight: 316.48
MDL number: MFCD00067132
EINECS: 209-297-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB295.20 | In Stock |
|
| 5g | RMB903.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| Boiling point: | 429.2±38.0 °C(Predicted) |
| Density | 1.048±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19H,4-12H2,1-3H3/t14,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | XMRPGKVKISIQBV-CVHNGYJVSA-N |
| SMILES | C1(=O)CC2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H](C(=O)C)CC3)CC2 |
| CAS DataBase Reference | 566-65-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,20-Allopregnanedione(566-65-4) |
Description and Uses
(5α)-Pregnane-3,20-dione exerts neuroprotective effects in chronic autoimmune encephalomyelitis (EAE). The neuroactivity of the steroid acts as a therapeutic agent for multiple sclerosis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H312-H302-H332-H351-H361fd |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P270-P301+P312-P330-P501-P201-P202-P281-P308+P313-P405-P501-P261-P271-P304+P340-P312 |
| WGK Germany | 3 |
| RTECS | TU4157150 |
| HS Code | 2937.29.9095 |







