PRODUCT Properties
| Melting point: | 185-187 °C(lit.) |
| Boiling point: | 461.0±45.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C21H28O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h6,12,16,18-19H,4-5,7-11H2,1-3H3/t16-,18-,19-,20-,21+/m0/s1 |
| InChIKey | VRRHHTISESGZFN-RKFFNLMFSA-N |
| SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(C(=O)C)=CC3)CC2 |
| CAS DataBase Reference | 1096-38-4(CAS DataBase Reference) |
Description and Uses
16-Dehydroprogesterone is used in the direct organocatalytic stereoselective transfer hydrogenation of conjugated olefins of steroids. 16-Dehydroprogesterone is a form of Progesterone (P755900), a steroid hormone produced by the corpus luteum that induces maturation and secretory activity of the uterine endothelium; suppresses ovulation. Progesterone is implicated in the etiology of breast cancer.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H351 |
| Precautionary statements | P280 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
