A1203712
4-Bromodiphenylamine , 97% , 54446-36-5
Synonym(s):
N-phenyl-4-bromoaniline;1-(4-Bromophenyl)aniline
CAS NO.:54446-36-5
Empirical Formula: C12H10BrN
Molecular Weight: 248.12
MDL number: MFCD07779504
EINECS: 626-191-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB93.60 | In Stock |
|
| 25G | RMB338.40 | In Stock |
|
| 100g | RMB997.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-89 °C |
| Boiling point: | 318°C(lit.) |
| Density | 1.445±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 0.11±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H10BrN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | CCIVUDMVXNBUCY-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(Br)C=C1 |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H411 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-37/38-41-51/53 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







