A1205312
3-Bromo-5-fluoropyridine , 97% , 407-20-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB70.40 | In Stock |
|
| 25G | RMB271.20 | In Stock |
|
| 100G | RMB916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24-28 °C |
| Boiling point: | 78 °C / 11mmHg |
| Density | 1.707±0.06 g/cm3(Predicted) |
| Flash point: | 148 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.45±0.20(Predicted) |
| form | Low Melting Solid or Liquid |
| color | Colorless to white |
| InChI | InChI=1S/C5H3BrFN/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | HNNNBQRRIHKFLI-UHFFFAOYSA-N |
| SMILES | C1=NC=C(F)C=C1Br |
| CAS DataBase Reference | 407-20-5(CAS DataBase Reference) |
Description and Uses
3-Bromo-5-fluoropyridine reacts with silylformamidine to afford aminals[3]. It serves as a starting material for the synthesis of 3-(benzylthio)-5-bromopyridine[4].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,F |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22-10 |
| Safety Statements | 26-39-36-16 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








