A1210712
4-tert-Butylphenylboronic acid , 97% , 123324-71-0
Synonym(s):
(p-tert-Butylphenyl)boronic acid;[4-(1,1-Dimethylethyl)phenyl]boronic acid;p-tert-Butylbenzeneboronic acid;4-t-Butylbenzeneboronic acid;4-t-Butylphenylboronic acid
CAS NO.:123324-71-0
Empirical Formula: C10H15BO2
Molecular Weight: 178.04
MDL number: MFCD01009697
EINECS: 602-928-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB115.20 | In Stock |
|
| 100G | RMB372.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-196 °C (lit.) |
| Boiling point: | 296.7±33.0 °C(Predicted) |
| Density | 1.02±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 8.79±0.10(Predicted) |
| color | White to off-white |
| BRN | 5330959 |
| InChI | InChI=1S/C10H15BO2/c1-10(2,3)8-4-6-9(7-5-8)11(12)13/h4-7,12-13H,1-3H3 |
| InChIKey | MNJYZNVROSZZQC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C(C)(C)C)C=C1)(O)O |
| CAS DataBase Reference | 123324-71-0(CAS DataBase Reference) |
Description and Uses
Cross-coupling building block used in synthesis of tetracycline derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22-20/21/22-R36/37/38 |
| Safety Statements | 37/39-26-36-S37/39-S26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |





