A6064212
Methyl p-tert-butylphenylacetate , 97% , 3549-23-3
Synonym(s):
Methyl 2-(4-tert-butylphenyl)acetate
CAS NO.:3549-23-3
Empirical Formula: C13H18O2
Molecular Weight: 206.28
MDL number: MFCD00051913
EINECS: 222-602-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB424.00 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 106 °C/2 mmHg (lit.) |
| Density | 0.999 g/mL at 25 °C (lit.) |
| FEMA | 2690 | METHYL P-TERT-BUTYLPHENYLACETATE |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Colourless to light yellow |
| Odor | at 100.00 %. dairy buttermilk leafy creamy green waxy fatty hyacinth melon rind rubbery |
| Odor Type | dairy |
| biological source | synthetic |
| JECFA Number | 1025 |
| BRN | 2502880 |
| Major Application | flavors and fragrances |
| InChI | 1S/C13H18O2/c1-13(2,3)11-7-5-10(6-8-11)9-12(14)15-4/h5-8H,9H2,1-4H3 |
| InChIKey | HXVTYMWVMVKVTF-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc(cc1)C(C)(C)C |
| LogP | 3.65 |
| CAS DataBase Reference | 3549-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetic acid, 4-(1,1-dimethylethyl)-, methyl ester (3549-23-3) |
Description and Uses
Methyl p-tert-butylphenylacetate has a sweet, woody, and camphoraceous odor with a roasted, chocolate-like flavor. May be prepared by esterification of p-tert-butylphenylacetic acid with methanol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |





