A1211012
4-(Benzyloxy)phenylboronic acid , 97% , 146631-00-7
CAS NO.:146631-00-7
Empirical Formula: C13H13BO3
Molecular Weight: 228.05
MDL number: MFCD01075705
EINECS: 678-070-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB213.60 | In Stock |
|
| 100g | RMB760.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-199 °C |
| Boiling point: | 418.9±47.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO, Methanol |
| pka | 8.70±0.16(Predicted) |
| form | solid |
| color | White to Off-White |
| InChI | 1S/C13H13BO3/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9,15-16H,10H2 |
| InChIKey | DMJHEIDWSIAXCS-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(OCc2ccccc2)cc1 |
| CAS DataBase Reference | 146631-00-7(CAS DataBase Reference) |
Description and Uses
4-Benzyloxybenzeneboronic Acid is a reagent in the synthesis of arylalkenylpropargylamines as neuroprotective and potent selective monoamine oxidase B inhibitors. Also used to prepare pyridone alkaloids used as antiproliferative agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 13 - Non Combustible Solids |






