A1212512
3-Bromobenzonitrile , 98% , 6952-59-6
CAS NO.：6952-59-6
Empirical Formula: C7H4BrN
Molecular Weight: 182.02
MDL number: MFCD00001796
EINECS: 230-127-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 10G | RMB24.80 | In Stock |
|
| 25g | RMB59.20 | In Stock |
|
| 50G | RMB100.00 | In Stock |
|
| 100g | RMB211.20 | In Stock |
|
| 250G | RMB491.20 | In Stock |
|
| 500g | RMB895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C(lit.) |
| Boiling point: | 225 °C(lit.) |
| Density | 1.562 |
| refractive index | 1.5999 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.2g/l |
| form | Crystalline Mass, Crystals or Crystalline Powder |
| color | White to light yellow or beige |
| Water Solubility | Soluble in water (0.2 g/L) |
| BRN | 1858942 |
| InChI | InChI=1S/C7H4BrN/c8-7-3-1-2-6(4-7)5-9/h1-4H |
| InChIKey | STXAVEHFKAXGOX-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(Br)=C1 |
| CAS DataBase Reference | 6952-59-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Bromobenzoic acid nitrile(6952-59-6) |
Description and Uses
3-Bromobenzonitrile is involved in the Suzuki reaction under solvent-free conditions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-52/53-36-21/22 |
| Safety Statements | 26-36-36/37/39-61 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DI2459500 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
