A1537412
3-Bromophenylacetic Acid , 95% , 1878-67-7
CAS NO.：1878-67-7
Empirical Formula: C8H7BrO2
Molecular Weight: 215.04
MDL number: MFCD00004330
EINECS: 217-522-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB18.40 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB108.80 | In Stock |
|
| 100G | RMB396.00 | In Stock |
|
| 500g | RMB1934.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C (lit.) |
| Boiling point: | 252.95°C (rough estimate) |
| Density | 1.5313 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 4.12±0.10(Predicted) |
| form | Crystalline Powder or Needles |
| color | White |
| BRN | 2045104 |
| InChI | InChI=1S/C8H7BrO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | KYNNBXCGXUOREX-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(Br)=C1 |
| CAS DataBase Reference | 1878-67-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Bromophenylacetic acid(1878-67-7) |
| EPA Substance Registry System | 3-Bromophenylacetic acid (1878-67-7) |
Description and Uses
3-Bromophenylacetic acid was used in the preparation of 3-bromophenylacetaldehyde by di-isobutyl aluminum hydride (DIBAL) reduction.
