A1217212
Benzoin ethyl ether , 97% , 574-09-4
Synonym(s):
α-Ethoxy-α-phenylacetophenone;2-Ethoxy-2-phenylacetophenone;Benzoin ethyl ether, 2-Ethoxy-2-phenylacetophenone;O-Ethylbenzoin
CAS NO.:574-09-4
Empirical Formula: C16H16O2
Molecular Weight: 240.3
MDL number: MFCD00009242
EINECS: 209-366-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 50G | RMB159.20 | In Stock |
|
| 100G | RMB164.00 | In Stock |
|
| 250G | RMB535.20 | In Stock |
|
| 500G | RMB724.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-61 °C(lit.) |
| Boiling point: | 194-195°C 20mm |
| Density | 1.1016 |
| refractive index | 1.5727 |
| Flash point: | 194-195°C/20mm |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,1093 |
| BRN | 2053926 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | InChI=1S/C16H16O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
| InChIKey | KMNCBSZOIQAUFX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1)C(OCC)C1=CC=CC=C1 |
| CAS DataBase Reference | 574-09-4(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2-ethoxy-1,2-diphenyl- (574-09-4) |
Description and Uses
Benzoin ethyl ether is a biological material or organic compound that can be used in life science research[1][2].
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS09,GHS06 |
| Signal word | Warning |
| Hazard statements | H317-H400-H410-H301 |
| Precautionary statements | P391-P501-P264-P270-P301+P310a-P321-P405-P501a-P273-P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 2914 50 00 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |








