A1217312
2-Bromo-m-xylene , 97% , 576-22-7
Synonym(s):
2-Bromo-m-xylene
CAS NO.:576-22-7
Empirical Formula: C8H9Br
Molecular Weight: 185.06
MDL number: MFCD00000075
EINECS: 209-397-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB26.40 | In Stock |
|
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB175.20 | In Stock |
|
| 250G | RMB423.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −10 °C(lit.) |
| Boiling point: | 206 °C(lit.) |
| Density | 1.389 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in aqueous solution. Very soluble in ethanol, soluble in acetone and benzene. |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.389 |
| BRN | 1929780 |
| InChI | InChI=1S/C8H9Br/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| InChIKey | MYMYVYZLMUEVED-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=CC(C)=C1Br |
| CAS DataBase Reference | 576-22-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,3-dimethyl-(576-22-7) |
Description and Uses
2-Bromo-m-xylene has been used to prepare 2,2?,4,6,6?-pentamethylbiphenyl. It is used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| RTECS | CY9020000 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







