A1219312
Benzil , 98% , 134-81-6
Synonym(s):
Benzil;Dibenzoyl;Diphenylethanedione
CAS NO.:134-81-6
Empirical Formula: C14H10O2
Molecular Weight: 210.23
MDL number: MFCD00003080
EINECS: 205-157-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB47.20 | In Stock |
|
| 500G | RMB119.20 | In Stock |
|
| 2.5KG | RMB454.40 | In Stock |
|
| 10kg | RMB1436.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-95 °C(lit.) |
| Boiling point: | 346 °C |
| Density | 1,521 g/cm3 |
| vapor pressure | 1 mm Hg ( 128.4 °C) |
| refractive index | 1.5681 (estimate) |
| Flash point: | 346-348°C |
| storage temp. | Store below +30°C. |
| solubility | <0.5g/l |
| form | Crystalline Powder |
| color | White |
| Water Solubility | 0.5 g/L (20 ºC) |
| Merck | 14,1078 |
| BRN | 608047 |
| Dielectric constant | 13.0(94℃) |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 134-81-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanedione, diphenyl-(134-81-6) |
| EPA Substance Registry System | Benzil (134-81-6) |
Description and Uses
Benzil is used as a pharmaceutical intermediate and uv curing resin photosensitizer. In polymer chemistry, it is used as a photoinitiator. Further, it serves as a potent inhibitor of human carboxylesterases. It is used in the preparation of diketimines by reacting with amines. It is also involved in the famous benil-benzilic acid rearrangement. In addition this, it reacts with 1,3-diphenylacetone to get tetraphenylcyclopentadienone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | DD1925000 |
| F | 10 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29143900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Toxicity | LD50 orally in Rabbit: 2710 mg/kg |






