A1219912
Benzoylhydrazine , 98% , 613-94-5
Synonym(s):
Benzoic acid hydrazide;Benzoylhydrazine
CAS NO.：613-94-5
Empirical Formula: C7H8N2O
Molecular Weight: 136.15
MDL number: MFCD00007596
EINECS: 210-363-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB28.80 | In Stock |
|
| 100G | RMB69.60 | In Stock |
|
| 250g | RMB159.20 | In Stock |
|
| 500G | RMB288.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C (lit.) |
| Boiling point: | 250.42°C (rough estimate) |
| Density | 1.1778 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | pK1: 3.03(+2);pK2: 12.45(+1) (25°C) |
| form | Needle-Like Crystals or Powder |
| color | White to beige |
| BRN | 471797 |
| InChI | InChI=1S/C7H8N2O/c8-9-7(10)6-4-2-1-3-5-6/h1-5H,8H2,(H,9,10) |
| InChIKey | WARCRYXKINZHGQ-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 613-94-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, hydrazide(613-94-5) |
| EPA Substance Registry System | Benzoic acid, hydrazide (613-94-5) |
Description and Uses
Benzoyl Hydrazine is an acyl hydrazide as potent antioxidant.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H351 |
| Precautionary statements | P201-P202-P264-P301+P312-P302+P352-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DH1575000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29280090 |
| Hazardous Substances Data | 613-94-5(Hazardous Substances Data) |
| Toxicity | LD50 scu-mus: 122 mg/kg JPETAB 122,110,58 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
