A1478012
Benzamide oxime , ≥98.0% , 613-92-3
Synonym(s):
N-Hydroxybenzamide
CAS NO.：613-92-3
Empirical Formula: C7H8N2O
Molecular Weight: 136.15
MDL number: MFCD06656049
EINECS: 210-361-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB54.40 | In Stock |
|
| 5G | RMB210.40 | In Stock |
|
| 25G | RMB837.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77°C |
| Boiling point: | 244℃ |
| Density | 1.18 |
| Flash point: | 102℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 6.85±0.69(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
| InChIKey | MXOQNVMDKHLYCZ-UHFFFAOYSA-N |
| SMILES | C1(C(NO)=N)=CC=CC=C1 |
| LogP | 1.024 |
| CAS DataBase Reference | 613-92-3(CAS DataBase Reference) |
Description and Uses
Benzamide Oxime is used to prepare aryloxadiazoles as apoptosis inducers and anticancer agents. It is also used in the synthesis of aryloxadiazolyltropane analogs of cocaine.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 23/24/25-36/37/38-25-20/21/22 |
| Safety Statements | 22-36/37/39-45-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CY6920000 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
