A1220512
Benzoic anhydride , 98% , 93-97-0
CAS NO.:93-97-0
Empirical Formula: C14H10O3
Molecular Weight: 226.23
MDL number: MFCD00003073
EINECS: 202-291-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB67.20 | In Stock |
|
| 500G | RMB276.80 | In Stock |
|
| 2.5kg | RMB1042.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C(lit.) |
| Boiling point: | 360 °C |
| Density | 1.199 g/mL at 25 °C(lit.) |
| refractive index | nD15 1.57665 |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 0.01g/l (experimental) |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| Water Solubility | 0.01 g/L |
| Sensitive | Moisture Sensitive |
| Merck | 14,1092 |
| BRN | 516726 |
| InChI | 1S/C14H10O3/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | CHIHQLCVLOXUJW-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 93-97-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, anhydride(93-97-0) |
| EPA Substance Registry System | Benzoic anhydride (93-97-0) |
Description and Uses
Benzoic anhydride is used as a benzoylating agent in the manufacture of pharmaceuticals, dyes and intermediates. It serves as an arylation agent in the Heck reaction. It is also used to get benzoic acid through dehydration. Further, it is used to prepare furan-2-yl-phenyl-methanone, which is similar to Friedel-Crafts acylation reaction. In addition to this, it is used for the synthesis of carboxylic esters and lactones.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H318-H372 |
| Precautionary statements | P260-P264-P280-P302+P352-P305+P351+P338-P314 |
| target organs | Lungs |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-36/37/38 |
| Safety Statements | 26-39-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT RE 1 Inhalation |






