A3938512
β-Estradiol 3-benzoate , 98% , 50-50-0
Synonym(s):
β-Estradiol 3-benzoate;1,3,5(10)-Estratriene-3,17β-diol 3-benzoate;3,17β-Dihydroxy-1,3,5(10)-estratriene 3-benzoate;3-Benzoyloxy-17β-estrol
CAS NO.:50-50-0
Empirical Formula: C25H28O3
Molecular Weight: 376.5
MDL number: MFCD00003692
EINECS: 200-043-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB47.20 | In Stock |
|
| 1G | RMB80.00 | In Stock |
|
| 5G | RMB226.40 | In Stock |
|
| 25G | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-198 °C(lit.) |
| alpha | D25 +58 to +63° (c = 2 in dioxane) |
| Boiling point: | 465.03°C (rough estimate) |
| Density | 1.0493 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, freely soluble in methylene chloride, sparingly soluble in acetone, slightly soluble in methanol. |
| form | Solid |
| pka | 15.06±0.40(Predicted) |
| color | White |
| Water Solubility | 0.4mg/L(25 ºC) |
| Merck | 3703 |
| BRN | 3107526 |
| InChIKey | UYIFTLBWAOGQBI-BZDYCCQFSA-N |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])CCc4cc(OC(=O)c5ccccc5)ccc24 |
| CAS DataBase Reference | 50-50-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Estradiol benzoate(50-50-0) |
Description and Uses
antiacne, antineoplastic
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 60-61-40 |
| Safety Statements | 53-22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | KG4050000 |
| F | 8 |
| HS Code | 29372319 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Repr. 1B |





