A1221112
4-Bromocinnamic Acid , 98% , 1200-07-3
CAS NO.:1200-07-3
Empirical Formula: C9H7BrO2
Molecular Weight: 227.05
MDL number: MFCD00004394
EINECS: 214-850-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260-265 °C |
| Boiling point: | 344.9±17.0 °C(Predicted) |
| Density | 1.607±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO |
| pka | 4.35±0.10(Predicted) |
| form | Solid |
| color | Whie |
| Water Solubility | Soluble in alcohol, ethyl acetate, DMSO. Insoluble in water. |
| BRN | 3538823 |
| InChI | InChI=1S/C9H7BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12) |
| InChIKey | CPDDDTNAMBSPRN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(Br)C=C1 |
| CAS DataBase Reference | 1200-07-3(CAS DataBase Reference) |
Description and Uses
4-Bromocinnamic acid has been used in the preparation of: (E)-β-bromo-4-bromostyrene, 2-amino-7-(piperidin-4-yl)isoquinoline, brominated dansyl derivative (4-bromophenyl)-4-(5-(dimethylamino)naphthalene-1-sulfonamido)butanoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 36/37/39-26-22 |
| WGK Germany | 3 |
| RTECS | UD3110000 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Toxicity | mouse,LD,intraperitoneal,> 250mg/kg (250mg/kg),BEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: REGIDITYBEHAVIORAL: ATAXIA,Indian Journal of Pharmaceutical Sciences. Vol. 49, Pg. 77, 1987. |





