A7586358
2-Ethylhexyl4-Methoxycinnamate , 10mMinDMSO , 5466-77-3
Synonym(s):
2-Ethylhexyl 4-methoxycinnamate;2-Ethylhexyl trans -4-methoxycinnamate;4-Methoxycinnamic acid 2-ethylhexyl ester;Octyl methoxycinnamate;OMC
CAS NO.:5466-77-3
Empirical Formula: C18H26O3
Molecular Weight: 290.4
MDL number: MFCD00072582
EINECS: 226-775-7
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-25℃ |
| Boiling point: | 198-200°C |
| Density | 1.009 |
| refractive index | 1.543-1.547 |
| Flash point: | 193°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Odor | Odorless |
| Water Solubility | <0.1 g/100 mL at 27 ºC |
| BRN | 5946632 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | UV ABSORBER UV FILTER LIGHT STABILIZER |
| InChI | 1S/C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h8-13,15H,4-7,14H2,1-3H3/b13-10+ |
| InChIKey | YBGZDTIWKVFICR-JLHYYAGUSA-N |
| SMILES | CCCCC(CC)COC(=O)\C=C\c1ccc(OC)cc1 |
| LogP | 5.921 (est) |
| CAS DataBase Reference | 5466-77-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenoic acid, 3-(4-methoxyphenyl)-, 2-ethylhexyl ester(5466-77-3) |
| EPA Substance Registry System | 2-Ethylhexyl p-methoxycinnamate (5466-77-3) |
Description and Uses
2-Ethylhexyl-4-methoxy-cinnamate is used as UV-B-absorbing agent in sunscreens and cosmetic creams, lotions, lipsticks, sun oils, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | nwg |
| RTECS | UD3392732 |
| TSCA | TSCA listed |
| HS Code | 29189090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
| Hazardous Substances Data | 5466-77-3(Hazardous Substances Data) |






