A1228412
Boc-Glu(OBzl)-OH , 97% , 13574-13-5
CAS NO.：13574-13-5
Empirical Formula: C17H23NO6
Molecular Weight: 337.37
MDL number: MFCD00065569
EINECS: 237-007-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 10g | RMB77.60 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100G | RMB513.60 | In Stock |
|
| 500g | RMB2340.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C |
| alpha | -16 º (c=2, DMF) |
| Boiling point: | 473.68°C (rough estimate) |
| Density | 1.1452 (rough estimate) |
| refractive index | -16.5 ° (C=2, DMF) |
| storage temp. | 2-8°C |
| solubility | Soluble in N,N- Dimethyl formamide. |
| pka | 3.81±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 5.5±0.5°, c = 1% in acetic acid |
| BRN | 2226572 |
| Sequence | Boc-Glu(OBzl) |
| Major Application | peptide synthesis |
| InChI | 1S/C17H23NO6/c1-17(2,3)24-16(22)18-13(15(20)21)9-10-14(19)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | AJDUMMXHVCMISJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 13574-13-5(CAS DataBase Reference) |
| EPA Substance Registry System | L-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(phenylmethyl) ester (13574-13-5) |
| CAS Number Unlabeled | 56-86-0 |
Description and Uses
N-Boc-L-glutamic acid 5-benzyl ester is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
