A1231112
O-Benzyl-L-serine , 99% , 4726-96-9
Synonym(s):
(S)-2-Amino-3-benzyloxypropionic acid
CAS NO.:4726-96-9
Empirical Formula: C10H13NO3
Molecular Weight: 195.22
MDL number: MFCD00065937
EINECS: 225-220-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB432.00 | In Stock |
|
| 100g | RMB1584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~227 °C (dec.) |
| Boiling point: | 359℃ |
| Density | 1.217 |
| refractive index | 7.3 ° (C=2, 1mol/L HCl) |
| Flash point: | 171℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Powder |
| pka | 2.10±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +21±2°, c = 2% in acetic acid: water (4:1) (+ 1 Eq HCl) |
| BRN | 2114846 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | IDGQXGPQOGUGIX-VIFPVBQESA-N |
| SMILES | N[C@@H](COCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 4726-96-9(CAS DataBase Reference) |
| EPA Substance Registry System | L-Serine, O-(phenylmethyl)- (4726-96-9) |
Description and Uses
O-Benzyl-L-Serine is used in the preparation of serine analogs as specific agonists for NMDA receptor glycine binding sites. It also functions as an eluent for ligand exchange chromatography for the separation of constrained glutamate receptor ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29225090 |
| Storage Class | 13 - Non Combustible Solids |







