A1235112
Bis(trifluoromethane)sulfonimide , 95% , 82113-65-3
Synonym(s):
Bis(trifluoromethanesulfonyl)amine;Bis(trifluoromethylsulfonyl)amine
CAS NO.:82113-65-3
Empirical Formula: C2HF6NO4S2
Molecular Weight: 281.15
MDL number: MFCD00214154
EINECS: 214-152-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 10g | RMB126.40 | In Stock |
|
| 25G | RMB196.80 | In Stock |
|
| 100G | RMB587.20 | In Stock |
|
| 500g | RMB2176.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-56 °C |
| Boiling point: | 90-91 °C(lit.) |
| Density | 1.36 |
| storage temp. | 2-8°C |
| solubility | 800g/l Risk of violent reaction. |
| form | Crystals |
| pka | -10.42±0.40(Predicted) |
| color | Colorless to brownish |
| PH | 0.8 (100g/l, H2O, 20℃)Risk of violent reaction. |
| BRN | 4754101 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Reacts violently with water. |
| InChI | 1S/C2HF6NO4S2/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9H |
| InChIKey | ZXMGHDIOOHOAAE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| LogP | -0.771 at 25.5℃ and pH6.7 |
| CAS DataBase Reference | 82113-65-3(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonamide, 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]- (82113-65-3) |
Description and Uses
Trifluoromethanesulfonimide may be used as a catalyst for the preparation of 1-substituted-1H-1,2,3,4-tetrazoles.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Signal word | Danger |
| Hazard statements | H301-H318-H412 |
| Hazard statements | H301-H318-H412 |
| Precautionary statements | P273-P280-P301+P310+P330-P305+P351+P338+P310 |
| Precautionary statements | P273-P280-P301+P310+P330-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-40-14-67-37 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | I |
| HS Code | 29350090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 |
| Excepted Quantities | Not Permitted as Excepted Quantity |






