A1240312
1-Bis(4-fluorophenyl)methyl piperazine , 97% , 27469-60-9
Synonym(s):
1-(4,4′-Difluorobenzhydryl)piperazine
CAS NO.:27469-60-9
Empirical Formula: C17H18F2N2
Molecular Weight: 288.33
MDL number: MFCD00038660
EINECS: 248-476-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB340.00 | In Stock |
|
| 100G | RMB1343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-92 °C(lit.) |
| Boiling point: | 130 °C |
| Density | 1.1462 (estimate) |
| vapor pressure | 0.001-0.003Pa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol,Toluene |
| pka | 9.00±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| Water Solubility | 0.34 g/L (20 ºC) |
| BRN | 620754 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C17H18F2N2/c18-15-5-1-13(2-6-15)17(21-11-9-20-10-12-21)14-3-7-16(19)8-4-14/h1-8,17,20H,9-12H2 |
| InChIKey | TTXIFFYPVGWLSE-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=C(F)C=C2)C2=CC=C(F)C=C2)CCNCC1 |
| LogP | 3.3-3.5 at pH7-11 |
| CAS DataBase Reference | 27469-60-9(CAS DataBase Reference) |
Description and Uses
1-Bis(4-fluorophenyl)methyl piperazine may be used to synthesize 1-[bis(4-fluorophenyl)methyl]-4-[3-[(N-ethoxycarbonyl-N-phenyl)amino]-2-hydroxypropyl]piperazine and (R, S) 3-[4-(bis(4-fluorophenyl)methyl)piperazin-1-yl]dihydrofuran-2(3H)-one.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 2 Eye Dam. 1 Skin Sens. 1A |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






