A3308612
2,4-Difluorobenzoic Acid , ≥98.0% , 1583-58-0
CAS NO.:1583-58-0
Empirical Formula: C7H4F2O2
Molecular Weight: 158.1
MDL number: MFCD00011670
EINECS: 216-430-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C (lit.) |
| Boiling point: | 239.5±20.0 °C(Predicted) |
| Density | 1.3486 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 3.21±0.10(Predicted) |
| form | Solid |
| color | Pale Orange to Light Pink |
| Water Solubility | SOLUBLE |
| BRN | 973355 |
| InChI | InChI=1S/C7H4F2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | NJYBIFYEWYWYAN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1F |
| CAS DataBase Reference | 1583-58-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Difluorobenzoic acid(1583-58-0) |
| EPA Substance Registry System | Benzoic acid, 2,4-difluoro- (1583-58-0) |
Description and Uses
2,4-Difluorobenzoic Acid (cas# 1583-58-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





