A1241312
5-Benzimidazolecarboxylic acid , 98% , 15788-16-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB230.40 | In Stock |
|
| 50g | RMB439.20 | In Stock |
|
| 100G | RMB780.00 | In Stock |
|
| 250g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 3.10±0.30(Predicted) |
| form | Powder |
| color | Green-gray to gray-brown |
| BRN | 5686 |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)5-1-2-6-7(3-5)10-4-9-6/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | COYPLDIXZODDDL-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(C(O)=O)=CC=C2N=1 |
| CAS DataBase Reference | 15788-16-6(CAS DataBase Reference) |
Description and Uses
5-Benzimidazolecarboxylic acid has been used in the preparation of:
- 1H-benzoimidazole-5-carboxylic acid benzotriazol-1-yl ester
- piperidin-1-yl(1-m-tolyl-1H-benzo[d]imidazol-5-yl)methanone
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







