A1243412
2-Bromofluorene , 97% , 1133-80-8
CAS NO.:1133-80-8
Empirical Formula: C13H9Br
Molecular Weight: 245.11
MDL number: MFCD00001115
EINECS: 214-480-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C (lit.) |
| Boiling point: | 185 °C/135 mmHg (lit.) |
| Density | 1.4187 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| Flash point: | 185°C/135mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and ethyl acetate. |
| form | Slightly Crystalline Powder or Flakes |
| color | White to slightly yellow |
| BRN | 1946701 |
| InChI | InChI=1S/C13H9Br/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | FXSCJZNMWILAJO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C2=C1C=C(Br)C=C2 |
| CAS DataBase Reference | 1133-80-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 9H-Fluorene, 2-bromo-(1133-80-8) |
Description and Uses
2-Bromofluorene was used in the synthesis of end-capping reagent 2-bromo-9,9-di-nhexylfluorene. It has been used in the preparation of poly(di-n-hexylfluorene)s end capped with 2-bromofluorene, 2-bromo-9,9-di-n-hexylfluorene and 9-bromoanthracene through Ni(0) mediated polymerization. It was also used in the synthesis of 2-bromo-9,9-dihexylfluorene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





