A1246812
tert-Butyl Diethylphosphonoacetate , 95% , 27784-76-5
Synonym(s):
(Diethoxyphosphinyl)acetic acid 1,1-dimethylethyl ester;tert-Butyl (diethoxyphosphinyl)acetate;Diethyl tert-butoxycarbonylmethanephosphonate
CAS NO.:27784-76-5
Empirical Formula: C10H21O5P
Molecular Weight: 252.24
MDL number: MFCD00075414
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB26.40 | In Stock |
|
| 25G | RMB52.80 | In Stock |
|
| 100G | RMB172.80 | In Stock |
|
| 500G | RMB692.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-103 °C/1.5 mmHg (lit.) |
| Density | 1.074 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| Specific Gravity | 1.074 |
| color | Clear colorless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2050126 |
| InChI | InChI=1S/C10H21O5P/c1-6-13-16(12,14-7-2)8-9(11)15-10(3,4)5/h6-8H2,1-5H3 |
| InChIKey | NFEGNISFSSLEGU-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)CP(OCC)(OCC)=O |
| CAS DataBase Reference | 27784-76-5(CAS DataBase Reference) |
Description and Uses
tert-Butyl diethylphosphonoacetate is used as a reactant for preparation of hydroxymethylated dihydroxyvitamin D3 analogs via Wittig-Horner approach, as potential antitumor agents, synthesis of phosphopeptide mimetic prodrugs targeted to Src homology 2 (SH2) domain of signal transducer and activator of transcription 3 (Stat 3) and bicyclic triaminophosphine-promoted stereoselective synthesis of a,-unsaturated esters, fluorides, and nitriles from aldehydes and ketones using Wadsworth-Emmons phosphonates
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves |
| Risk Statements | 36/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |





