A1249712
                    Benzidine dihydrochloride , AR,99.0% , 531-85-1
                            Synonym(s):
4,4′-Diaminobiphenyl dihydrochloride
                            
                        
                CAS NO.:531-85-1
Empirical Formula: C12H13ClN2
Molecular Weight: 220.7
MDL number: MFCD00040389
EINECS: 208-519-6
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | ≥300 °C | 
                                    
| form | powder | 
                                    
| color | Leaflets | 
                                    
| Water Solubility | 0.1-0.5 g/100 mL at 23.5 ºC | 
                                    
| BRN | 3914846 | 
                                    
| InChI | InChI=1S/C12H12N2.ClH/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;/h1-8H,13-14H2;1H | 
                                    
| InChIKey | FYRTZXXTIDKEJD-UHFFFAOYSA-N | 
                                    
| SMILES | NC1C=CC(C2C=CC(N)=CC=2)=CC=1.Cl | 
                                    
| CAS DataBase Reference | 531-85-1(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Benzidine dihydrochloride (531-85-1) | 
                                    
Description and Uses
The dihydrochlorie salt of Benzidine (B121000) a common used in dyes and environmental testing.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09  | 
                                    
| Signal word | Danger | 
| Hazard statements | H302-H350-H410 | 
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 | 
| Hazard Codes | T,N,Xn | 
| Risk Statements | 45-22-50/53-36/37/38-20/21/22 | 
| Safety Statements | 53-45-60-61-36-26 | 
| RIDADR | UN 2811 6.1/PG 2 | 
| WGK Germany | 3 | 
| RTECS | DD0600000 | 
| Toxicity | mmo-sat 100 nmol/plate MUREAV 136,33,84 | 






![2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/5177-43-5.gif)


