A1252850
(1,2-Dibromoethyl)benzene , 98% , 93-52-7
Synonym(s):
1,2-Dibromo-1-phenylethane;Phenylethylene bromide;Styrene dibromide
CAS NO.:93-52-7
Empirical Formula: C8H8Br2
Molecular Weight: 263.96
MDL number: MFCD00000138
EINECS: 202-253-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB47.20 | In Stock |
|
| 100g | RMB155.20 | In Stock |
|
| 500g | RMB591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-74 °C (lit.) |
| Boiling point: | 139-141 °C/15 mmHg (lit.) |
| Density | 1.74 |
| refractive index | 1.6113 (estimate) |
| Flash point: | 139-140°C/15mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Light yellow to light brown |
| BRN | 907323 |
| InChI | InChI=1S/C8H8Br2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | SHKKTLSDGJRCTR-UHFFFAOYSA-N |
| SMILES | C1(C(Br)CBr)=CC=CC=C1 |
| CAS DataBase Reference | 93-52-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, (1,2-dibromoethyl)- (93-52-7) |
Description and Uses
- Effects of the biocide methylisothiazolinone on Xenopus laevis wound healing and tail regeneration.: The study assesses the impact of 2-Methyl-4-isothiazolin-3-one on regenerative processes in amphibians, contributing to the understanding of its biological effects and potential toxicity (Delos Santos et al., 2016).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ1800100 |
| F | 8-19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






![10,11-DIBROMO-10,11-DIHYDRO-5H-DIBENZO[A,D]CYCLOHEPTEN-5-ONE](https://img.chemicalbook.com/CAS/GIF/39654-52-9.gif)