A1253612
N-(tert-Butoxycarbonyl)-L-serine , 97% , 3262-72-4
CAS NO.:3262-72-4
Empirical Formula: C8H15NO5
Molecular Weight: 205.21
MDL number: MFCD00037243
EINECS: 221-867-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB343.20 | In Stock |
|
| 500G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91 °C (dec.)(lit.) |
| alpha | -7.5 º (c=2, water) |
| Boiling point: | 385.1±37.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| refractive index | -4 ° (C=1, AcOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.62±0.10(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D 3.5±0.5°, c = 2% in acetic acid |
| Water Solubility | almost transparency |
| BRN | 2212252 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H15NO5/c1-8(2,3)14-7(13)9-5(4-10)6(11)12/h5,10H,4H2,1-3H3,(H,9,13)(H,11,12)/t5-/m0/s1 |
| InChIKey | FHOAKXBXYSJBGX-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(O)=O |
| CAS DataBase Reference | 3262-72-4(CAS DataBase Reference) |
Description and Uses
Boc-Ser-OH may be used in the synthesis of the following:
- 2-(N-Fmoc)-3-(N-Boc-N-methoxy)-diaminopropanoic acid (Fmoc: 9-fluorenylmethoxycarbonyl; Boc: t-butyloxycarbonyl)
- Boc-Ser-Leu-OMe
- cyclic peptide synthesis
- benzylsulfonyl-D-Ser-Ser-4-amidinobenzylamide
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |







