Benzyl triethyl ammonium bromide , 98% , 5197-95-5
CAS NO.:5197-95-5
Empirical Formula: C13H22BrN
Molecular Weight: 272.22
MDL number: MFCD00011822
EINECS: 225-986-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB84.80 | In Stock |
|
| 500G | RMB313.60 | In Stock |
|
| 2.5kg | RMB1416.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 193-195 °C (dec.) (lit.) |
| Density | 1.2838 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Off-white |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 3739113 |
| InChI | 1S/C13H22N.BrH/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;/h7-11H,4-6,12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CHQVQXZFZHACQQ-UHFFFAOYSA-M |
| SMILES | [Br-].CC[N+](CC)(CC)Cc1ccccc1 |
| CAS DataBase Reference | 5197-95-5(CAS DataBase Reference) |
Description and Uses
Benzyltriethylammonium bromide is a versatile quaternary ammonium salt widely utilized in various chemical and industrial applications.
Benzyltriethylammonium bromide is recognized for its effectiveness as a phase transfer catalyst, facilitating the transfer of ions between immiscible phases, which enhances reaction rates in organic synthesis. Its ability to solubilize organic compounds in aqueous solutions makes it invaluable in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Researchers often leverage its properties in the preparation of quaternary ammonium compounds, surfactants, and as a reagent in organic reactions, such as alkylation and acylation processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






