A1254212
Boc-L-Asp(OBzl)-OH , 98% , 7536-58-5
Synonym(s):
N-(tert-Butoxycarbonyl)-L -aspartic acid 4-benzyl ester;Boc-L -aspartic acid 4-benzyl ester;Boc-Asp(OBzl)-OH;N-α-t.-Boc-L-aspartic acid β-benzyl ester
CAS NO.:7536-58-5
Empirical Formula: C16H21NO6
Molecular Weight: 323.34
MDL number: MFCD00065564
EINECS: 231-406-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB250.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-102 °C(lit.) |
| alpha | -20 º (c=2, DMF) |
| Boiling point: | 461.82°C (rough estimate) |
| Density | 1.1728 (rough estimate) |
| refractive index | -20 ° (C=2, DMF) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | almost transparency in N,N-DMF |
| pka | 3.65±0.23(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D 20.0±1°, c = 2% in DMF |
| BRN | 2064127 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C16H21NO6/c1-16(2,3)23-15(21)17-12(14(19)20)9-13(18)22-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | SOHLZANWVLCPHK-LBPRGKRZSA-N |
| SMILES | C(O)(=O)[C@H](CC(OCC1=CC=CC=C1)=O)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 7536-58-5(CAS DataBase Reference) |
| EPA Substance Registry System | N-tert-Butoxycarbonyl-L-aspartic acid .beta.-benzyl ester (7536-58-5) |
Description and Uses
N-?[(1,?1-?Dimethylethoxy)?carbonyl]?-?L-?Aspartic acid 4-?(Phenylmethyl) Ester is L-Aspartic Acid (A790024) with side chain and N-terminus protected. L-Aspartic Acid is a non-essential amino acid found in food sources.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |




