BD9003531
Boc-Asp(OMe)-OH , 97% , 59768-74-0
Synonym(s):
Boc-L -aspartic acid 4-methyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB56.80 | In Stock |
|
| 10g | RMB101.60 | In Stock |
|
| 25g | RMB144.80 | In Stock |
|
| 100g | RMB517.60 | In Stock |
|
| 500g | RMB2524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solution |
| color | Clear colorless to yellow |
| BRN | 4810472 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H17NO6/c1-10(2,3)17-9(15)11-6(8(13)14)5-7(12)16-4/h6H,5H2,1-4H3,(H,11,15)(H,13,14)/t6-/m0/s1 |
| InChIKey | WFPSMPYVXFVVFA-LURJTMIESA-N |
| SMILES | COC(=O)C[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 59768-74-0(CAS DataBase Reference) |
Description and Uses
Boc-L-aspartic Acid β-Methyl Ester is used to prepare isoxazoline glycoprotein IIb/IIIa antagonists. It is also used to synthesize glutamic acid analogs as potent inhibitors of leukotriene A4 hydrolase.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
