A1256650
benzene-1,3,5-triyltriboronicacid , 98% , 89641-21-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB142.40 | In Stock |
|
| 500mg | RMB639.20 | In Stock |
|
| 1g | RMB1199.20 | In Stock |
|
| 5g | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 648.5±65.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.67±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C6H9B3O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3,10-15H |
| InChIKey | NAIUYXOLMQYLIG-UHFFFAOYSA-N |
| SMILES | C1(B(O)O)=CC(B(O)O)=CC(B(O)O)=C1 |
Description and Uses
Benzene-1,3,5-triyltriboronic acid is used as a monomer for the synthesis of COF materials: COF-6; COF-11A/14A/16A/18A; Ph-An-COF; [12+8]cages.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |







