A1694712
Benzene-<WBR>1,3,5-<WBR>tricarboxaldehyde , 97% , 3163-76-6
Synonym(s):
1,3,5-Triformylbenzene;Trimesaldehyde
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB31.20 | In Stock |
|
| 250MG | RMB93.60 | In Stock |
|
| 1g | RMB288.00 | In Stock |
|
| 200mg | RMB404.00 | In Stock |
|
| 5g | RMB1256.00 | In Stock |
|
| 25g | RMB5199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-161°C |
| Boiling point: | 329.3±37.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C9H6O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h1-6H |
| InChIKey | AEKQNAANFVOBCU-UHFFFAOYSA-N |
| SMILES | C1(C=O)=CC(C=O)=CC(C=O)=C1 |
Description and Uses
Benzene-1,3,5-tricarboxaldehyde is extensively used in the synthesis of a wide range of porous organic cages and covalent organic frameworks.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29122990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







