A6914712
Pyromellitic Acid , >98.0%(T) , 89-05-4
Synonym(s):
1,2,4,5-Benzenetetracarboxylic acid;Benzene-1,2,4,5-tetracarboxylic acid;Pyromellitic acid
CAS NO.:89-05-4
Empirical Formula: C10H6O8
Molecular Weight: 254.15
MDL number: MFCD00002471
EINECS: 201-879-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB67.20 | In Stock |
|
| 500G | RMB151.20 | In Stock |
|
| 2.5KG | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 281-284.5 °C(lit.) |
| Boiling point: | 317.36°C (rough estimate) |
| Density | 0,56 g/cm3 |
| refractive index | 1.7010 (estimate) |
| Flash point: | 325 °C |
| storage temp. | Store below +30°C. |
| solubility | 0.1 M NaOH: 0.2 M, clear, faintly yellow |
| pka | pK1: 1.92;pK2: 2.87;pK3: 4.49;pK4: 5.63 (25°C) |
| form | Crystalline Powder |
| color | White to very slightly yellow |
| Water Solubility | 1.5 g/100 mL (20 ºC) |
| Merck | 14,8004 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C10H6O8/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | CYIDZMCFTVVTJO-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(C(O)=O)c(cc1C(O)=O)C(O)=O |
| LogP | 0.15 at 25℃ |
| CAS DataBase Reference | 89-05-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2,4,5-Benzene-tetracarboxylic acid(89-05-4) |
| EPA Substance Registry System | 1,2,4,5-Benzenetetracarboxylic acid (89-05-4) |
Description and Uses
1,2,4,5-benzenetetracarboxylic acid is used for the synthesis of the polyimide, pyromellitic octyl, etc., it is the main raw material of matting curing agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | DB9275000 |
| F | 34 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |




