A1257412
Boc-D-Asn-OH , 98% , 75647-01-7
Synonym(s):
Boc-D -asparagine;Boc-D-Asn-OH;N-α-t.-Boc-D-asparagine
CAS NO.:75647-01-7
Empirical Formula: C9H16N2O5
Molecular Weight: 232.23
MDL number: MFCD00065558
EINECS: 231-405-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB41.60 | In Stock |
|
| 25G | RMB140.00 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| 500g | RMB1796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-169 °C |
| alpha | 9 º (c=1, DMF) |
| Boiling point: | 374.39°C (rough estimate) |
| Density | 1.2896 (rough estimate) |
| refractive index | 7.7 ° (C=1, DMF) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Dimethylformamide |
| pka | 3.79±0.10(Predicted) |
| form | Powder |
| color | White |
| BRN | 4843040 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H16N2O5/c1-9(2,3)16-8(15)11-5(7(13)14)4-6(10)12/h5H,4H2,1-3H3,(H2,10,12)(H,11,15)(H,13,14)/t5-/m1/s1 |
| InChIKey | FYYSQDHBALBGHX-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(N)=O)C(O)=O |
| CAS DataBase Reference | 75647-01-7(CAS DataBase Reference) |
Description and Uses
Nα-Boc-D-asparagine is an N-Boc-protected form of D-Asparagine (A788990). D-Asparagine is an isomer of L-Asparagine (A790005) and is used by bacteria (such as Saccharomyces cerevisiae) as a sole nitrogen source for replication. L-Asparagine is also a competitive inhibitor of staphylococcal L-asparaginase and is used as a reagent to synthesize peptide antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 24/25-45 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |





