A1258412
3,3′,4,4′-Biphenyltetracarboxylic dianhydride , 97% , 2420-87-3
Synonym(s):
s-BPDA
CAS NO.:2420-87-3
Empirical Formula: C16H6O6
Molecular Weight: 294.22
MDL number: MFCD00039140
EINECS: 219-342-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB67.20 | In Stock |
|
| 100G | RMB177.60 | In Stock |
|
| 500g | RMB631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 299-305 °C (lit.) |
| Boiling point: | 614.9±48.0 °C(Predicted) |
| Density | 1.625±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency in hot DMF |
| form | powder to crystal |
| color | Off-white |
| λmax | 300nm(lit.) |
| InChI | InChI=1S/C16H6O6/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18/h1-6H |
| InChIKey | WKDNYTOXBCRNPV-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(C3C=CC4C(=O)OC(=O)C=4C=3)C=C2)C(=O)O1 |
| LogP | 3.91 |
| CAS DataBase Reference | 2420-87-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,3',4,4'-Biphenyltetracarboxylic acid dianhydride(2420-87-3) |
| EPA Substance Registry System | [5,5'-Biisobenzofuran]-1,1',3,3'-tetrone (2420-87-3) |
Description and Uses
3,3',4,4'-biphenyltetracarboxylic dianhydride be used for the preparation of a polyimide material.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |







