A1262612
1-Bromo-4-tert-butylbenzene , 97% , 3972-65-4
CAS NO.:3972-65-4
Empirical Formula: C10H13Br
Molecular Weight: 213.11
MDL number: MFCD00000108
EINECS: 223-599-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB136.00 | In Stock |
|
| 500G | RMB464.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13-16 °C(lit.) |
| Boiling point: | 80-81 °C2 mm Hg(lit.) |
| Density | 1.229 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 97 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 1.229 |
| Water Solubility | Insoluble in water. |
| BRN | 1859117 |
| InChI | InChI=1S/C10H13Br/c1-10(2,3)8-4-6-9(11)7-5-8/h4-7H,1-3H3 |
| InChIKey | XHCAGOVGSDHHNP-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 3972-65-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-(1,1-dimethylethyl)-(3972-65-4) |
Description and Uses
1-Bromo-4-tert-butylbenzene was used in the synthesis of 4-tert-butyl-phenylboronic acid1, 1-deoxy analogs of CP-47,497 (n = 0 to 7) and 1-deoxy analogs of CP-55,940 (n = 0 to 7). It undergoes lithium-bromide exchange reactions with n-butyllithium and tert-butyllithium at 0°C in various solvents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |




