A1263712
2-Bromo-3-pyridinol , 98% , 6602-32-0
Synonym(s):
2-Bromo-3-hydroxypyridine
CAS NO.：6602-32-0
Empirical Formula: C5H4BrNO
Molecular Weight: 174
MDL number: MFCD00006220
EINECS: 229-547-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-188 °C(lit.) |
| Boiling point: | 321.7±22.0 °C(Predicted) |
| Density | 1.5643 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 4.32±0.10(Predicted) |
| color | Light brown to gray |
| Water Solubility | Soluble in alcohol. Insoluble in water. |
| BRN | 109829 |
| InChI | InChI=1S/C5H4BrNO/c6-5-4(8)2-1-3-7-5/h1-3,8H |
| InChIKey | YKHQFTANTNMYPP-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1O |
| CAS DataBase Reference | 6602-32-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinol, 2-bromo-(6602-32-0) |
Description and Uses
2-Bromo-3-hydroxypyridine is used to produce 2-bromo-4,6-diiodo-3-pyridinol. It is also used in azo dyes and in the synthesis of pterocellin A by reacting with kojic acid and in synthesis of orelline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| RTECS | UU7705000 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
