A1264012
2-Bromo-3-methylpyridine , 97% , 3430-17-9
CAS NO.:3430-17-9
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00239380
EINECS: 629-415-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB81.60 | In Stock |
|
| 100G | RMB220.80 | In Stock |
|
| 500g | RMB870.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 218-219 °C (lit.) |
| Density | 1.544 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.08±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.55 |
| color | Clear slightly yellow to light brown |
| BRN | 107896 |
| InChI | InChI=1S/C6H6BrN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| InChIKey | PZSISEFPCYMBDL-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1C |
| CAS DataBase Reference | 3430-17-9(CAS DataBase Reference) |
Description and Uses
2-Bromo-3-methylpyridine is a diazido compound with a hydrogen bond. It reacts rapidly with copper chloride to form the coordination complex Cu(diazido)(Cl)2 and an organic product.
2-Bromo-3-methylpyridine is a halogenated pyridine analogue containing a bromine functional group. The substance is used as a reaction reagent and as a basic structural unit in organic synthesis for the preparation of other heterocyclic compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






