A1271612
Boc-Tyr-OMe , 99% , 4326-36-7
Synonym(s):
N-(tert-Butoxycarbonyl)-L -tyrosine methyl ester;Boc-L -tyrosine methyl ester
CAS NO.：4326-36-7
Empirical Formula: C15H21NO5
Molecular Weight: 295.33
MDL number: MFCD00191181
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB188.80 | In Stock |
|
| 500G | RMB763.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-104 °C(lit.) |
| alpha | 51 º (c=1 in chloroform) |
| Boiling point: | 452.7±40.0 °C(Predicted) |
| Density | 1.169±0.06 g/cm3(Predicted) |
| refractive index | 50 ° (C=1, MeOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| pka | 9.75±0.15(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to pale yellow |
| optical activity | [α]22/D +51°, c = 1 in chloroform |
| InChI | InChI=1S/C15H21NO5/c1-15(2,3)21-14(19)16-12(13(18)20-4)9-10-5-7-11(17)8-6-10/h5-8,12,17H,9H2,1-4H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | NQIFXJSLCUJHBB-LBPRGKRZSA-N |
| SMILES | C(OC)(=O)[C@H](CC1=CC=C(O)C=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 4326-36-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P271-P261-P280 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
