A7665812
L-Tyrosine , 99% , 60-18-4
Synonym(s):
L-Tyrosine;TYR;Tyrosinase;(S)-(-)-Tyrosine;Monophenol monooxygenase
CAS NO.:60-18-4
Empirical Formula: C9H11NO3
Molecular Weight: 181.19
MDL number: MFCD00002606
EINECS: 200-460-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB78.40 | In Stock |
|
| 250g | RMB183.20 | In Stock |
|
| 500G | RMB270.40 | In Stock |
|
| 2.5KG | RMB976.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (dec.) (lit.) |
| Boiling point: | 314.29°C (rough estimate) |
| alpha | -11.65 º (c=5,DIL HCL/H2O 50/50) |
| Density | 1.34 |
| bulk density | 300kg/m3 |
| refractive index | -12 ° (C=5, 1mol/L HCl) |
| FEMA | 3736 | L-TYROSINE |
| Flash point: | 176 °C |
| storage temp. | Store below +30°C. |
| solubility | 1 M HCl: 25 mg/mL |
| form | powder |
| pka | 2.2(at 25℃) |
| color | White to Pale-brown |
| PH | 6.5 (0.1g/l, H2O) |
| Odor | odorless |
| Odor Type | odorless |
| biological source | rabbit |
| optical activity | [α]20/D 11.5±1.0°, c = 4% in 1 M HCl |
| Water Solubility | 0.45 g/L (25 ºC) |
| Merck | 14,9839 |
| JECFA Number | 1434 |
| BRN | 392441 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | HAIR CONDITIONING FRAGRANCE ANTISTATIC SKIN CONDITIONING |
| InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | OUYCCCASQSFEME-QMMMGPOBSA-N |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(O)=O |
| LogP | 0.38 |
| CAS DataBase Reference | 60-18-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Tyrosine(60-18-4) |
| EPA Substance Registry System | L-Tyrosine (60-18-4) |
| Absorption | cut-off at 310nm in 1 M HCl at 0.5M |
Description and Uses
L-Tyrosine is one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-37/39-22 |
| WGK Germany | 3 |
| RTECS | YP2275600 |
| TSCA | TSCA listed |
| HS Code | 29225000 |
| Storage Class | 13 - Non Combustible Solids |
| Hazardous Substances Data | 60-18-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 5110 mg/kg |




