A7765212
L-Tryptophan , Non-animal source, EP, JP, USP; for cell culture, 99.0-101.0% , 73-22-3
Synonym(s):
L-Tryptophan;Trp;(S)-(-)-Tryptophan;L -α-Amino-3-indolepropionic acid;L -Tryptophan
CAS NO.:73-22-3
Empirical Formula: C11H12N2O2
Molecular Weight: 204.23
MDL number: MFCD00064340
EINECS: 200-795-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500g | RMB375.20 | In Stock |
|
| 1KG | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289-290 °C (dec.)(lit.) |
| Boiling point: | 342.72°C (rough estimate) |
| alpha | -31.1 º (c=1, H20) |
| Density | 1.34 |
| bulk density | 400kg/m3 |
| refractive index | -32 ° (C=1, H2O) |
| storage temp. | 2-8°C |
| solubility | 20% NH3: 0.1 g/mL at 20 °C, clear, colorless |
| form | powder |
| pka | 2.46(at 25℃) |
| color | White to yellow-white |
| PH | 5.5-7.0 (10g/l, H2O, 20℃) |
| Odor | wh. cryst. or cryst. odorless powd., sl. bitter taste |
| biological source | non-animal source |
| optical activity | [α]20/D 31.5±1°, c = 1% in H2O |
| Water Solubility | 11.4 g/L (25 ºC) |
| Merck | 14,9797 |
| BRN | 86197 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Cosmetics Ingredients Functions | HAIR CONDITIONING ANTISTATIC FRAGRANCE |
| InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | QIVBCDIJIAJPQS-VIFPVBQESA-N |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O |
| LogP | 0.704 (est) |
| CAS DataBase Reference | 73-22-3(CAS DataBase Reference) |
| NIST Chemistry Reference | L-Tryptophan(73-22-3) |
| EPA Substance Registry System | L-Tryptophan (73-22-3) |
| Absorption | cut-off at 326nm in 0.5 M HCl at 0.5M |
Description and Uses
adrenergic agonist
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H314-H225-H290 |
| Precautionary statements | P501-P240-P210-P233-P234-P243-P241-P242-P264-P280-P370+P378-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P406-P405 |
| Hazard Codes | Xi |
| Risk Statements | 33-40-62-41-37/38-36/37/38-22 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 2 |
| RTECS | YN6130000 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 73-22-3(Hazardous Substances Data) |
| Toxicity | LD508mmol / kg (rat, intraperitoneal injection). It is safe when used in food (FDA, §172.320, 2000). |





