A7681512
D-Tryptophan , 98% , 153-94-6
Synonym(s):
(R)-2-Amino-3-(3-indolyl)propionic acid;D -α-Amino-3-indolepropionic acid
CAS NO.:153-94-6
Empirical Formula: C11H12N2O2
Molecular Weight: 204.23
MDL number: MFCD00005647
EINECS: 205-819-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB148.80 | In Stock |
|
| 250G | RMB319.20 | In Stock |
|
| 500g | RMB621.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 282-285 °C (dec.)(lit.) |
| alpha | 31.5 º (c=1, H2O 24 ºC) |
| Boiling point: | 342.72°C (rough estimate) |
| Density | 1.1754 (rough estimate) |
| refractive index | 31 ° (C=1, H2O) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) |
| pka | 2.30±0.10(Predicted) |
| form | Powder |
| color | White to slightly yellow |
| biological source | synthetic (organic) |
| optical activity | Consistent with structure |
| Water Solubility | 11 g/L (20 ºC) |
| BRN | 86198 |
| Stability: | Stable. Incompatible with oxidizing agents. |
| InChI | 1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | QIVBCDIJIAJPQS-SECBINFHSA-N |
| SMILES | N[C@H](Cc1c[nH]c2ccccc12)C(O)=O |
| LogP | 0.704 (est) |
| CAS DataBase Reference | 153-94-6(CAS DataBase Reference) |
| EPA Substance Registry System | D-Tryptophan (153-94-6) |
Description and Uses
D-Tryptophan is used for human embryonic kidney cell (HEK-293, ATCC: CRL-1573) culture. The product is a sweetener used to study the release of incretins from enteroendocrine cells triggered by sugar but not by sweeteners.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 3 |
| RTECS | YN6129000 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |





