A1273812
1-Bromo-2,4-dimethoxybenzene , 98% , 17715-69-4
CAS NO.:17715-69-4
Empirical Formula: C8H9BrO2
Molecular Weight: 217.06
MDL number: MFCD00009844
EINECS: 241-717-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100G | RMB371.20 | In Stock |
|
| 500G | RMB1558.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-26 °C(lit.) |
| Boiling point: | 153-155 °C18 mm Hg(lit.) |
| Density | 1.507 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.507 |
| color | Clear slightly yellow |
| Water Solubility | insoluble |
| BRN | 1867593 |
| InChI | InChI=1S/C8H9BrO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| InChIKey | NIUZVSQOXJIHBL-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OC)C=C1OC |
| CAS DataBase Reference | 17715-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2,4-dimethoxy-(17715-69-4) |
Description and Uses
1-Bromo-2,4-dimethoxybenzene was used in the synthesis of 2,3-disubstituted benzo[b]furans. It was also used in the synthesis of dendrimer Si[CH2CH2Si(Me)2-2,4-(MeO)2-C6H3]4.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







