A1275512
4-Bromo-2-methylthiophene , 98% , 29421-92-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB417.60 | In Stock |
|
| 100G | RMB1441.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 74-76 °C/20 mmHg (lit.) |
| Density | 1.581 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C5H5BrS/c1-4-2-5(6)3-7-4/h2-3H,1H3 |
| InChIKey | ABMUSXPGSSMPLK-UHFFFAOYSA-N |
| SMILES | C1(C)SC=C(Br)C=1 |
| CAS DataBase Reference | 29421-92-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-41-20/21/22 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







